C10H12N2 — CID 175933789
3-pyridin-3-yl-3-azabicyclo[3.1.0]hexane (PubChem CID 175933789) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-pyridin-3-yl-3-azabicyclo[3.1.0]hexane.
| Compound Name | 3-pyridin-3-yl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 175933789 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3-pyridin-3-yl-3-azabicyclo[3.1.0]hexane |
| SMILES | c1cncc(N2CC3CC3C2)c1 |
| InChI | InChI=1S/C10H12N2/c1-2-10(5-11-3-1)12-6-8-4-9(8)7-12/h1-3,5,8-9H,4,6-7H2 |
| InChIKey | GXWNJEAVCAMGAU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |