C11H11N3 — CID 175920749
1-pyridin-3-yl-3,6-dihydro-2H-pyridine-3-carbonitrile (PubChem CID 175920749) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 1-pyridin-3-yl-3,6-dihydro-2H-pyridine-3-carbonitrile.
| Compound Name | 1-pyridin-3-yl-3,6-dihydro-2H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 175920749 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 1-pyridin-3-yl-3,6-dihydro-2H-pyridine-3-carbonitrile |
| SMILES | N#CC1C=CCN(c2cccnc2)C1 |
| InChI | InChI=1S/C11H11N3/c12-7-10-3-2-6-14(9-10)11-4-1-5-13-8-11/h1-5,8,10H,6,9H2 |
| InChIKey | VDZXKPYQYCIFIV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|