About [4-(4-pyridin-3-ylpiperazin-1-yl)phenyl]azanium;hydroxide;hydrate
[4-(4-pyridin-3-ylpiperazin-1-yl)phenyl]azanium;hydroxide;hydrate (PubChem CID 159789123) has the molecular formula C15H22N4O2
and a molecular weight of 290.37 g/mol. Its IUPAC name is [4-(4-pyridin-3-ylpiperazin-1-yl)phenyl]azanium;hydroxide;hydrate.
Molecular Properties
| Compound Name | [4-(4-pyridin-3-ylpiperazin-1-yl)phenyl]azanium;hydroxide;hydrate |
| PubChem CID | 159789123 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | [4-(4-pyridin-3-ylpiperazin-1-yl)phenyl]azanium;hydroxide;hydrate |
| SMILES | O.[NH3+]c1ccc(N2CCN(c3cccnc3)CC2)cc1.[OH-] |
| InChI | InChI=1S/C15H18N4.2H2O/c16-13-3-5-14(6-4-13)18-8-10-19(11-9-18)15-2-1-7-17-12-15;;/h1-7,12H,8-11,16H2;2*1H2 |
| InChIKey | VQWXTTISSBHHJS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-pyridin-3-ylpiperazin-1-yl)phenyl]azanium;hydroxide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-pyridin-3-ylpiperazin-1-yl)phenyl]azanium;hydroxide;hydrate?
The IUPAC name of [4-(4-pyridin-3-ylpiperazin-1-yl)phenyl]azanium;hydroxide;hydrate (CID 159789123) is [4-(4-pyridin-3-ylpiperazin-1-yl)phenyl]azanium;hydroxide;hydrate.
What is the SMILES notation for [4-(4-pyridin-3-ylpiperazin-1-yl)phenyl]azanium;hydroxide;hydrate?
The canonical SMILES for [4-(4-pyridin-3-ylpiperazin-1-yl)phenyl]azanium;hydroxide;hydrate is O.[NH3+]c1ccc(N2CCN(c3cccnc3)CC2)cc1.[OH-].
What is the InChIKey of [4-(4-pyridin-3-ylpiperazin-1-yl)phenyl]azanium;hydroxide;hydrate?
The InChIKey is VQWXTTISSBHHJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4.2H2O/c16-13-3-5-14(6-4-13)18-8-10-19(11-9-18)15-2-1-7-17-12-15;;/h1-7,12H,8-11,16H2;2*1H2.
What are the key properties of [4-(4-pyridin-3-ylpiperazin-1-yl)phenyl]azanium;hydroxide;hydrate?
[4-(4-pyridin-3-ylpiperazin-1-yl)phenyl]azanium;hydroxide;hydrate has a molecular weight of 290.37 g/mol, XLogP of 0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-pyridin-3-ylpiperazin-1-yl)phenyl]azanium;hydroxide;hydrate is sourced from PubChem (CID 159789123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).