C18H18N6 — CID 22639462
1,3-dipyridin-2-yl-5-pyridin-3-yl-1,3,5-triazinane (PubChem CID 22639462) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is 1,3-dipyridin-2-yl-5-pyridin-3-yl-1,3,5-triazinane.
| Compound Name | 1,3-dipyridin-2-yl-5-pyridin-3-yl-1,3,5-triazinane |
|---|---|
| PubChem CID | 22639462 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1,3-dipyridin-2-yl-5-pyridin-3-yl-1,3,5-triazinane |
| SMILES | c1ccc(N2CN(c3cccnc3)CN(c3ccccn3)C2)nc1 |
| InChI | InChI=1S/C18H18N6/c1-3-10-20-17(7-1)23-13-22(16-6-5-9-19-12-16)14-24(15-23)18-8-2-4-11-21-18/h1-12H,13-15H2 |
| InChIKey | NJCTWUWGPPKAGG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |