C19H19N4OP — CID 56695362
5-phenyl-1,3-dipyridin-2-yl-1,3,5λ5-diazaphosphinane 5-oxide (PubChem CID 56695362) has the molecular formula C19H19N4OP and a molecular weight of 350.36 g/mol. Its IUPAC name is 5-phenyl-1,3-dipyridin-2-yl-1,3,5λ5-diazaphosphinane 5-oxide.
| Compound Name | 5-phenyl-1,3-dipyridin-2-yl-1,3,5λ5-diazaphosphinane 5-oxide |
|---|---|
| PubChem CID | 56695362 |
| Molecular Formula | C19H19N4OP |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 5-phenyl-1,3-dipyridin-2-yl-1,3,5λ5-diazaphosphinane 5-oxide |
| SMILES | O=P1(c2ccccc2)CN(c2ccccn2)CN(c2ccccn2)C1 |
| InChI | InChI=1S/C19H19N4OP/c24-25(17-8-2-1-3-9-17)15-22(18-10-4-6-12-20-18)14-23(16-25)19-11-5-7-13-21-19/h1-13H,14-16H2 |
| InChIKey | WGGWYIDITIXACS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|