C13H18N2 — CID 10774486
(1S,5R,6R)-8-methyl-6-pyridin-3-yl-8-azabicyclo[3.2.1]octane (PubChem CID 10774486) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (1S,5R,6R)-8-methyl-6-pyridin-3-yl-8-azabicyclo[3.2.1]octane.
| Compound Name | (1S,5R,6R)-8-methyl-6-pyridin-3-yl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 10774486 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (1S,5R,6R)-8-methyl-6-pyridin-3-yl-8-azabicyclo[3.2.1]octane |
| SMILES | CN1[C@H]2CCC[C@@H]1[C@@H](c1cccnc1)C2 |
| InChI | InChI=1S/C13H18N2/c1-15-11-5-2-6-13(15)12(8-11)10-4-3-7-14-9-10/h3-4,7,9,11-13H,2,5-6,8H2,1H3/t11-,12+,13+/m0/s1 |
| InChIKey | YNTYODWLJKPEEZ-YNEHKIRRSA-N |
| XLogP | 2.42 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |