C11H15N — CID 167340168
3-[(1S,2R)-2-propan-2-ylcyclopropyl]pyridine (PubChem CID 167340168) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 3-[(1S,2R)-2-propan-2-ylcyclopropyl]pyridine.
| Compound Name | 3-[(1S,2R)-2-propan-2-ylcyclopropyl]pyridine |
|---|---|
| PubChem CID | 167340168 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 3-[(1S,2R)-2-propan-2-ylcyclopropyl]pyridine |
| SMILES | CC(C)[C@H]1C[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C11H15N/c1-8(2)10-6-11(10)9-4-3-5-12-7-9/h3-5,7-8,10-11H,6H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | KNYOOZPGMVDFSM-GHMZBOCLSA-N |
| XLogP | 2.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |