C10H13N — CID 142709158
3-[(1R,2R)-2-ethylcyclopropyl]pyridine (PubChem CID 142709158) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 3-[(1R,2R)-2-ethylcyclopropyl]pyridine.
| Compound Name | 3-[(1R,2R)-2-ethylcyclopropyl]pyridine |
|---|---|
| PubChem CID | 142709158 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 3-[(1R,2R)-2-ethylcyclopropyl]pyridine |
| SMILES | CC[C@@H]1C[C@H]1c1cccnc1 |
| InChI | InChI=1S/C10H13N/c1-2-8-6-10(8)9-4-3-5-11-7-9/h3-5,7-8,10H,2,6H2,1H3/t8-,10-/m1/s1 |
| InChIKey | NHAPGOCMXNSRNR-PSASIEDQSA-N |
| XLogP | 2.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |