C16H19NSi — CID 134966228
dimethyl-phenyl-[(1S,2R)-2-pyridin-3-ylcyclopropyl]silane (PubChem CID 134966228) has the molecular formula C16H19NSi and a molecular weight of 253.42 g/mol. Its IUPAC name is dimethyl-phenyl-[(1S,2R)-2-pyridin-3-ylcyclopropyl]silane.
| Compound Name | dimethyl-phenyl-[(1S,2R)-2-pyridin-3-ylcyclopropyl]silane |
|---|---|
| PubChem CID | 134966228 |
| Molecular Formula | C16H19NSi |
| Molecular Weight | 253.42 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | dimethyl-phenyl-[(1S,2R)-2-pyridin-3-ylcyclopropyl]silane |
| SMILES | C[Si](C)(c1ccccc1)[C@H]1C[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C16H19NSi/c1-18(2,14-8-4-3-5-9-14)16-11-15(16)13-7-6-10-17-12-13/h3-10,12,15-16H,11H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | FBTWQPVSXNAKAR-CVEARBPZSA-N |
| XLogP | 3.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|