C13H17ClN2 — CID 10728546
(1R,5S)-6-(6-chloro-3-pyridinyl)-8-methyl-8-azabicyclo[3.2.1]octane (PubChem CID 10728546) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is (1R,5S)-6-(6-chloro-3-pyridinyl)-8-methyl-8-azabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-6-(6-chloro-3-pyridinyl)-8-methyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 10728546 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | (1R,5S)-6-(6-chloro-3-pyridinyl)-8-methyl-8-azabicyclo[3.2.1]octane |
| SMILES | CN1[C@@H]2CCC[C@H]1C(c1ccc(Cl)nc1)C2 |
| InChI | InChI=1S/C13H17ClN2/c1-16-10-3-2-4-12(16)11(7-10)9-5-6-13(14)15-8-9/h5-6,8,10-12H,2-4,7H2,1H3/t10-,11?,12+/m1/s1 |
| InChIKey | ZLUUEWORLURLJD-LWALXPGCSA-N |
| XLogP | 3.08 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|