C18H19ClN2 — CID 10756535
(1R,2S,4S)-7-benzyl-2-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane (PubChem CID 10756535) has the molecular formula C18H19ClN2 and a molecular weight of 298.82 g/mol. Its IUPAC name is (1R,2S,4S)-7-benzyl-2-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,2S,4S)-7-benzyl-2-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 10756535 |
| Molecular Formula | C18H19ClN2 |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (1R,2S,4S)-7-benzyl-2-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane |
| SMILES | Clc1ccc([C@@H]2C[C@@H]3CC[C@H]2N3Cc2ccccc2)cn1 |
| InChI | InChI=1S/C18H19ClN2/c19-18-9-6-14(11-20-18)16-10-15-7-8-17(16)21(15)12-13-4-2-1-3-5-13/h1-6,9,11,15-17H,7-8,10,12H2/t15-,16-,17+/m0/s1 |
| InChIKey | BCRLMZKKAYOPSV-YESZJQIVSA-N |
| XLogP | 4.26 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|