C19H19ClN2O2 — CID 15428541
benzyl (1R,4R,5R)-5-(6-chloro-3-pyridinyl)-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 15428541) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is benzyl (1R,4R,5R)-5-(6-chloro-3-pyridinyl)-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | benzyl (1R,4R,5R)-5-(6-chloro-3-pyridinyl)-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 15428541 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | benzyl (1R,4R,5R)-5-(6-chloro-3-pyridinyl)-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@@H]2C[C@H]1C[C@H]2c1ccc(Cl)nc1 |
| InChI | InChI=1S/C19H19ClN2O2/c20-18-7-6-14(10-21-18)17-9-16-8-15(17)11-22(16)19(23)24-12-13-4-2-1-3-5-13/h1-7,10,15-17H,8-9,11-12H2/t15-,16-,17-/m0/s1 |
| InChIKey | IVCIXUHJTHTMML-ULQDDVLXSA-N |
| XLogP | 4.25 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|