C15H22N2O2P2 — CID 158562234
benzyl (1R,4R,5R)-5-[(2-methyldiphosphanyl)amino]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 158562234) has the molecular formula C15H22N2O2P2 and a molecular weight of 324.30 g/mol. Its IUPAC name is benzyl (1R,4R,5R)-5-[(2-methyldiphosphanyl)amino]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | benzyl (1R,4R,5R)-5-[(2-methyldiphosphanyl)amino]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 158562234 |
| Molecular Formula | C15H22N2O2P2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | benzyl (1R,4R,5R)-5-[(2-methyldiphosphanyl)amino]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CPPN[C@@H]1C[C@H]2C[C@@H]1CN2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H22N2O2P2/c1-20-21-16-14-8-13-7-12(14)9-17(13)15(18)19-10-11-5-3-2-4-6-11/h2-6,12-14,16,20-21H,7-10H2,1H3/t12-,13-,14-/m1/s1 |
| InChIKey | XJIHOZXQEWDRIW-MGPQQGTHSA-N |
| XLogP | 3.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|