C12H16N2O2 — CID 170915415
benzyl (2R,3S)-3-amino-2-methylazetidine-1-carboxylate (PubChem CID 170915415) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is benzyl (2R,3S)-3-amino-2-methylazetidine-1-carboxylate.
| Compound Name | benzyl (2R,3S)-3-amino-2-methylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 170915415 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | benzyl (2R,3S)-3-amino-2-methylazetidine-1-carboxylate |
| SMILES | C[C@@H]1[C@@H](N)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H16N2O2/c1-9-11(13)7-14(9)12(15)16-8-10-5-3-2-4-6-10/h2-6,9,11H,7-8,13H2,1H3/t9-,11+/m1/s1 |
| InChIKey | RWBYPDNMIKUZTG-KOLCDFICSA-N |
| XLogP | 1.35 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |