C13H17NO3 — CID 168975628
benzyl (2R,3R)-3-methoxy-2-methylazetidine-1-carboxylate (PubChem CID 168975628) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is benzyl (2R,3R)-3-methoxy-2-methylazetidine-1-carboxylate.
| Compound Name | benzyl (2R,3R)-3-methoxy-2-methylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 168975628 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | benzyl (2R,3R)-3-methoxy-2-methylazetidine-1-carboxylate |
| SMILES | CO[C@@H]1CN(C(=O)OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C13H17NO3/c1-10-12(16-2)8-14(10)13(15)17-9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3/t10-,12-/m1/s1 |
| InChIKey | DRHPDEFHFGYJKV-ZYHUDNBSSA-N |
| XLogP | 2.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |