About benzyl 5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate
benzyl 5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 19773719) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is benzyl 5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate.
Analyze benzyl 5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate?
The IUPAC name of benzyl 5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (CID 19773719) is benzyl 5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate.
What is the SMILES notation for benzyl 5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate?
The canonical SMILES for benzyl 5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate is CN1CC2CC1CN2C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate?
The InChIKey is QEYLEOPCHCGYHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2/c1-15-8-13-7-12(15)9-16(13)14(17)18-10-11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3.
What are the key properties of benzyl 5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate?
benzyl 5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate has a molecular weight of 246.31 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate is sourced from PubChem (CID 19773719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).