C18H19N5O4 — CID 25190333
benzyl 5-[5-(hydroxycarbamoyl)pyrimidin-2-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 25190333) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is benzyl 5-[5-(hydroxycarbamoyl)pyrimidin-2-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | benzyl 5-[5-(hydroxycarbamoyl)pyrimidin-2-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 25190333 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | benzyl 5-[5-(hydroxycarbamoyl)pyrimidin-2-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=C(NO)c1cnc(N2CC3CC2CN3C(=O)OCc2ccccc2)nc1 |
| InChI | InChI=1S/C18H19N5O4/c24-16(21-26)13-7-19-17(20-8-13)22-9-15-6-14(22)10-23(15)18(25)27-11-12-4-2-1-3-5-12/h1-5,7-8,14-15,26H,6,9-11H2,(H,21,24) |
| InChIKey | QDCGBCGCTLFTLE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|