C24H25N5O4 — CID 118005857
benzyl 4-[[5-(hydroxycarbamoyl)pyrimidin-2-yl]amino]-4-phenylpiperidine-1-carboxylate (PubChem CID 118005857) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is benzyl 4-[[5-(hydroxycarbamoyl)pyrimidin-2-yl]amino]-4-phenylpiperidine-1-carboxylate.
| Compound Name | benzyl 4-[[5-(hydroxycarbamoyl)pyrimidin-2-yl]amino]-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 118005857 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | benzyl 4-[[5-(hydroxycarbamoyl)pyrimidin-2-yl]amino]-4-phenylpiperidine-1-carboxylate |
| SMILES | O=C(NO)c1cnc(NC2(c3ccccc3)CCN(C(=O)OCc3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C24H25N5O4/c30-21(28-32)19-15-25-22(26-16-19)27-24(20-9-5-2-6-10-20)11-13-29(14-12-24)23(31)33-17-18-7-3-1-4-8-18/h1-10,15-16,32H,11-14,17H2,(H,28,30)(H,25,26,27) |
| InChIKey | PUEMTDXYALMOKO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|