C21H18N2O6 — CID 70468975
(2S)-4-(1,3-dioxoisoindol-2-yl)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (PubChem CID 70468975) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is (2S)-4-(1,3-dioxoisoindol-2-yl)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-(1,3-dioxoisoindol-2-yl)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70468975 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (2S)-4-(1,3-dioxoisoindol-2-yl)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC(N2C(=O)c3ccccc3C2=O)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H18N2O6/c24-18-15-8-4-5-9-16(15)19(25)23(18)14-10-17(20(26)27)22(11-14)21(28)29-12-13-6-2-1-3-7-13/h1-9,14,17H,10-12H2,(H,26,27)/t14?,17-/m0/s1 |
| InChIKey | SNBVMEJVMNLWDW-JRZJBTRGSA-N |
| XLogP | 2.15 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|