C19H28N2O5 — CID 126475877
cyclohexanamine;4-hydroxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (PubChem CID 126475877) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is cyclohexanamine;4-hydroxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid.
| Compound Name | cyclohexanamine;4-hydroxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 126475877 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | cyclohexanamine;4-hydroxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| SMILES | NC1CCCCC1.O=C(O)C1CC(O)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H15NO5.C6H13N/c15-10-6-11(12(16)17)14(7-10)13(18)19-8-9-4-2-1-3-5-9;7-6-4-2-1-3-5-6/h1-5,10-11,15H,6-8H2,(H,16,17);6H,1-5,7H2 |
| InChIKey | UTZXTBMGZZUMOW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |