C13H16N2O4 — CID 18520553
benzyl 2-carbamoyl-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 18520553) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is benzyl 2-carbamoyl-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-carbamoyl-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18520553 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | benzyl 2-carbamoyl-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | NC(=O)C1CC(O)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H16N2O4/c14-12(17)11-6-10(16)7-15(11)13(18)19-8-9-4-2-1-3-5-9/h1-5,10-11,16H,6-8H2,(H2,14,17) |
| InChIKey | DOZXKCLMAMGRPB-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |