C20H28N2O4 — CID 563091
benzyl 2-(cycloheptylcarbamoyl)-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 563091) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is benzyl 2-(cycloheptylcarbamoyl)-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-(cycloheptylcarbamoyl)-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 563091 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | benzyl 2-(cycloheptylcarbamoyl)-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | O=C(NC1CCCCCC1)C1CC(O)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H28N2O4/c23-17-12-18(19(24)21-16-10-6-1-2-7-11-16)22(13-17)20(25)26-14-15-8-4-3-5-9-15/h3-5,8-9,16-18,23H,1-2,6-7,10-14H2,(H,21,24) |
| InChIKey | VJMZIVMLTLPVFE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |