C26H32N2O3 — CID 126009936
benzyl (3R)-3-(cyclooctylcarbamoyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 126009936) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is benzyl (3R)-3-(cyclooctylcarbamoyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | benzyl (3R)-3-(cyclooctylcarbamoyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 126009936 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | benzyl (3R)-3-(cyclooctylcarbamoyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | O=C(NC1CCCCCCC1)[C@H]1Cc2ccccc2CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H32N2O3/c29-25(27-23-15-7-2-1-3-8-16-23)24-17-21-13-9-10-14-22(21)18-28(24)26(30)31-19-20-11-5-4-6-12-20/h4-6,9-14,23-24H,1-3,7-8,15-19H2,(H,27,29)/t24-/m1/s1 |
| InChIKey | RWKFFXWFXYZAND-XMMPIXPASA-N |
| XLogP | 4.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |