C23H29NO5 — CID 22819404
(2S,4S)-4-(1-adamantyloxy)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (PubChem CID 22819404) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is (2S,4S)-4-(1-adamantyloxy)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-(1-adamantyloxy)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22819404 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (2S,4S)-4-(1-adamantyloxy)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](OC23CC4CC(CC(C4)C2)C3)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H29NO5/c25-21(26)20-9-19(13-24(20)22(27)28-14-15-4-2-1-3-5-15)29-23-10-16-6-17(11-23)8-18(7-16)12-23/h1-5,16-20H,6-14H2,(H,25,26)/t16?,17?,18?,19-,20-,23?/m0/s1 |
| InChIKey | COJQVAZBCQBXMH-DJUYYZKXSA-N |
| XLogP | 3.84 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |