C20H22N4O4 — CID 143892303
benzyl (1R)-5-[2-[5-(hydroxycarbamoyl)pyrimidin-2-yl]ethyl]-2-azabicyclo[2.2.0]hexane-2-carboxylate (PubChem CID 143892303) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is benzyl (1R)-5-[2-[5-(hydroxycarbamoyl)pyrimidin-2-yl]ethyl]-2-azabicyclo[2.2.0]hexane-2-carboxylate.
| Compound Name | benzyl (1R)-5-[2-[5-(hydroxycarbamoyl)pyrimidin-2-yl]ethyl]-2-azabicyclo[2.2.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 143892303 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | benzyl (1R)-5-[2-[5-(hydroxycarbamoyl)pyrimidin-2-yl]ethyl]-2-azabicyclo[2.2.0]hexane-2-carboxylate |
| SMILES | O=C(NO)c1cnc(CCC2C[C@@H]3C2CN3C(=O)OCc2ccccc2)nc1 |
| InChI | InChI=1S/C20H22N4O4/c25-19(23-27)15-9-21-18(22-10-15)7-6-14-8-17-16(14)11-24(17)20(26)28-12-13-4-2-1-3-5-13/h1-5,9-10,14,16-17,27H,6-8,11-12H2,(H,23,25)/t14?,16?,17-/m1/s1 |
| InChIKey | UTOBBCWMNMDXQV-BDVYOWHSSA-N |
| XLogP | 2.19 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|