C13H14BrNO3 — CID 53305965
benzyl (1R,4S,5R,6R)-5-bromo-6-hydroxy-2-azabicyclo[2.1.1]hexane-2-carboxylate (PubChem CID 53305965) has the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. Its IUPAC name is benzyl (1R,4S,5R,6R)-5-bromo-6-hydroxy-2-azabicyclo[2.1.1]hexane-2-carboxylate.
| Compound Name | benzyl (1R,4S,5R,6R)-5-bromo-6-hydroxy-2-azabicyclo[2.1.1]hexane-2-carboxylate |
|---|---|
| PubChem CID | 53305965 |
| Molecular Formula | C13H14BrNO3 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | benzyl (1R,4S,5R,6R)-5-bromo-6-hydroxy-2-azabicyclo[2.1.1]hexane-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@H]2[C@@H](O)[C@@H]1[C@@H]2Br |
| InChI | InChI=1S/C13H14BrNO3/c14-10-9-6-15(11(10)12(9)16)13(17)18-7-8-4-2-1-3-5-8/h1-5,9-12,16H,6-7H2/t9-,10-,11+,12-/m1/s1 |
| InChIKey | XENYZQBQUARTHS-WISYIIOYSA-N |
| XLogP | 1.76 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|