C13H13BrClNO2 — CID 11002052
benzyl (1R,4S,5R,6S)-5-bromo-6-chloro-2-azabicyclo[2.1.1]hexane-2-carboxylate (PubChem CID 11002052) has the molecular formula C13H13BrClNO2 and a molecular weight of 330.61 g/mol. Its IUPAC name is benzyl (1R,4S,5R,6S)-5-bromo-6-chloro-2-azabicyclo[2.1.1]hexane-2-carboxylate.
| Compound Name | benzyl (1R,4S,5R,6S)-5-bromo-6-chloro-2-azabicyclo[2.1.1]hexane-2-carboxylate |
|---|---|
| PubChem CID | 11002052 |
| Molecular Formula | C13H13BrClNO2 |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | benzyl (1R,4S,5R,6S)-5-bromo-6-chloro-2-azabicyclo[2.1.1]hexane-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@H]2[C@H](Cl)[C@@H]1[C@@H]2Br |
| InChI | InChI=1S/C13H13BrClNO2/c14-10-9-6-16(12(10)11(9)15)13(17)18-7-8-4-2-1-3-5-8/h1-5,9-12H,6-7H2/t9-,10-,11+,12+/m1/s1 |
| InChIKey | URYJVILRCZPPQN-WYUUTHIRSA-N |
| XLogP | 3.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|