C20H19ClN2O2 — CID 171971271
benzyl 3-(6-chloro-3-pyridinyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 171971271) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is benzyl 3-(6-chloro-3-pyridinyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | benzyl 3-(6-chloro-3-pyridinyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 171971271 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | benzyl 3-(6-chloro-3-pyridinyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C2C=C(c3ccc(Cl)nc3)CC1CC2 |
| InChI | InChI=1S/C20H19ClN2O2/c21-19-9-6-15(12-22-19)16-10-17-7-8-18(11-16)23(17)20(24)25-13-14-4-2-1-3-5-14/h1-6,9-10,12,17-18H,7-8,11,13H2 |
| InChIKey | BEYQOOOAXIBUDP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|