C22H21Cl2NO2 — CID 171969223
benzyl 3-(3,5-dichlorophenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171969223) has the molecular formula C22H21Cl2NO2 and a molecular weight of 402.32 g/mol. Its IUPAC name is benzyl 3-(3,5-dichlorophenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | benzyl 3-(3,5-dichlorophenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171969223 |
| Molecular Formula | C22H21Cl2NO2 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | benzyl 3-(3,5-dichlorophenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C2C=C(c3cc(Cl)cc(Cl)c3)CC1CCC2 |
| InChI | InChI=1S/C22H21Cl2NO2/c23-18-9-16(10-19(24)13-18)17-11-20-7-4-8-21(12-17)25(20)22(26)27-14-15-5-2-1-3-6-15/h1-3,5-6,9-11,13,20-21H,4,7-8,12,14H2 |
| InChIKey | ULBIISWZEJSAMZ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |