C24H27NO3 — CID 171968197
benzyl 3-(4-methoxy-3-methylphenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171968197) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is benzyl 3-(4-methoxy-3-methylphenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | benzyl 3-(4-methoxy-3-methylphenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171968197 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | benzyl 3-(4-methoxy-3-methylphenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | COc1ccc(C2=CC3CCCC(C2)N3C(=O)OCc2ccccc2)cc1C |
| InChI | InChI=1S/C24H27NO3/c1-17-13-19(11-12-23(17)27-2)20-14-21-9-6-10-22(15-20)25(21)24(26)28-16-18-7-4-3-5-8-18/h3-5,7-8,11-14,21-22H,6,9-10,15-16H2,1-2H3 |
| InChIKey | KAKWFFWPZXDTTE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |