C26H31NO3 — CID 171967441
benzyl 3-(4-butoxyphenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171967441) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is benzyl 3-(4-butoxyphenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | benzyl 3-(4-butoxyphenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171967441 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | benzyl 3-(4-butoxyphenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | CCCCOc1ccc(C2=CC3CCCC(C2)N3C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H31NO3/c1-2-3-16-29-25-14-12-21(13-15-25)22-17-23-10-7-11-24(18-22)27(23)26(28)30-19-20-8-5-4-6-9-20/h4-6,8-9,12-15,17,23-24H,2-3,7,10-11,16,18-19H2,1H3 |
| InChIKey | VLFHSOMCLOITTN-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|