C23H25NO3 — CID 171969101
benzyl 3-(3-methoxyphenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171969101) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is benzyl 3-(3-methoxyphenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | benzyl 3-(3-methoxyphenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171969101 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | benzyl 3-(3-methoxyphenyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | COc1cccc(C2=CC3CCCC(C2)N3C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H25NO3/c1-26-22-12-5-9-18(15-22)19-13-20-10-6-11-21(14-19)24(20)23(25)27-16-17-7-3-2-4-8-17/h2-5,7-9,12-13,15,20-21H,6,10-11,14,16H2,1H3 |
| InChIKey | AKUNMDKUUMQBEI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |