C22H20F3NO3 — CID 171967849
benzyl 3-[3-(trifluoromethoxy)phenyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 171967849) has the molecular formula C22H20F3NO3 and a molecular weight of 403.40 g/mol. Its IUPAC name is benzyl 3-[3-(trifluoromethoxy)phenyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | benzyl 3-[3-(trifluoromethoxy)phenyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 171967849 |
| Molecular Formula | C22H20F3NO3 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | benzyl 3-[3-(trifluoromethoxy)phenyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C2C=C(c3cccc(OC(F)(F)F)c3)CC1CC2 |
| InChI | InChI=1S/C22H20F3NO3/c23-22(24,25)29-20-8-4-7-16(13-20)17-11-18-9-10-19(12-17)26(18)21(27)28-14-15-5-2-1-3-6-15/h1-8,11,13,18-19H,9-10,12,14H2 |
| InChIKey | RGOUGNDEOQMBIJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |