C22H23NO2S — CID 171969693
benzyl 3-(3-methylsulfanylphenyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 171969693) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is benzyl 3-(3-methylsulfanylphenyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | benzyl 3-(3-methylsulfanylphenyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 171969693 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | benzyl 3-(3-methylsulfanylphenyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | CSc1cccc(C2=CC3CCC(C2)N3C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C22H23NO2S/c1-26-21-9-5-8-17(14-21)18-12-19-10-11-20(13-18)23(19)22(24)25-15-16-6-3-2-4-7-16/h2-9,12,14,19-20H,10-11,13,15H2,1H3 |
| InChIKey | CIXGONXUAOEUSA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |