C21H20Cl2N2O2 — CID 171969409
benzyl 3-(2,5-dichloro-4-pyridinyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171969409) has the molecular formula C21H20Cl2N2O2 and a molecular weight of 403.31 g/mol. Its IUPAC name is benzyl 3-(2,5-dichloro-4-pyridinyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | benzyl 3-(2,5-dichloro-4-pyridinyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171969409 |
| Molecular Formula | C21H20Cl2N2O2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | benzyl 3-(2,5-dichloro-4-pyridinyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C2C=C(c3cc(Cl)ncc3Cl)CC1CCC2 |
| InChI | InChI=1S/C21H20Cl2N2O2/c22-19-12-24-20(23)11-18(19)15-9-16-7-4-8-17(10-15)25(16)21(26)27-13-14-5-2-1-3-6-14/h1-3,5-6,9,11-12,16-17H,4,7-8,10,13H2 |
| InChIKey | MDJCLGLLEMCUFQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|