C20H23N3O2 — CID 171970903
benzyl 3-(3-methylimidazol-4-yl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171970903) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is benzyl 3-(3-methylimidazol-4-yl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | benzyl 3-(3-methylimidazol-4-yl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171970903 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | benzyl 3-(3-methylimidazol-4-yl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | Cn1cncc1C1=CC2CCCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H23N3O2/c1-22-14-21-12-19(22)16-10-17-8-5-9-18(11-16)23(17)20(24)25-13-15-6-3-2-4-7-15/h2-4,6-7,10,12,14,17-18H,5,8-9,11,13H2,1H3 |
| InChIKey | HITGAKVBYBMUNW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |