C27H33BN2O4 — CID 171966642
benzyl 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171966642) has the molecular formula C27H33BN2O4 and a molecular weight of 460.38 g/mol. Its IUPAC name is benzyl 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | benzyl 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171966642 |
| Molecular Formula | C27H33BN2O4 |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | benzyl 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | CC1(C)OB(c2cncc(C3=CC4CCCC(C3)N4C(=O)OCc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C27H33BN2O4/c1-26(2)27(3,4)34-28(33-26)22-13-21(16-29-17-22)20-14-23-11-8-12-24(15-20)30(23)25(31)32-18-19-9-6-5-7-10-19/h5-7,9-10,13-14,16-17,23-24H,8,11-12,15,18H2,1-4H3 |
| InChIKey | PZFRVOVOYVQEIK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|