C14H18ClN — CID 13382844
(1R,5S)-8-benzyl-3-chloro-8-azabicyclo[3.2.1]octane (PubChem CID 13382844) has the molecular formula C14H18ClN and a molecular weight of 235.76 g/mol. Its IUPAC name is (1R,5S)-8-benzyl-3-chloro-8-azabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-8-benzyl-3-chloro-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 13382844 |
| Molecular Formula | C14H18ClN |
| Molecular Weight | 235.76 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (1R,5S)-8-benzyl-3-chloro-8-azabicyclo[3.2.1]octane |
| SMILES | ClC1C[C@H]2CC[C@@H](C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C14H18ClN/c15-12-8-13-6-7-14(9-12)16(13)10-11-4-2-1-3-5-11/h1-5,12-14H,6-10H2/t12?,13-,14+ |
| InChIKey | VFIMALKXGXQWPK-AGUYFDCRSA-N |
| XLogP | 3.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|