C14H19N — CID 67134573
(1R,5S)-8-benzyl-8-azabicyclo[3.2.1]octane (PubChem CID 67134573) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (1R,5S)-8-benzyl-8-azabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-8-benzyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 67134573 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (1R,5S)-8-benzyl-8-azabicyclo[3.2.1]octane |
| SMILES | c1ccc(CN2[C@@H]3CCC[C@H]2CC3)cc1 |
| InChI | InChI=1S/C14H19N/c1-2-5-12(6-3-1)11-15-13-7-4-8-14(15)10-9-13/h1-3,5-6,13-14H,4,7-11H2/t13-,14+ |
| InChIKey | MVSNFUWCTULLSI-OKILXGFUSA-N |
| XLogP | 3.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |