C15H24Cl2N2 — CID 138376241
(1R,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-amine;dihydrochloride (PubChem CID 138376241) has the molecular formula C15H24Cl2N2 and a molecular weight of 303.28 g/mol. Its IUPAC name is (1R,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-amine;dihydrochloride.
| Compound Name | (1R,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 138376241 |
| Molecular Formula | C15H24Cl2N2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (1R,5S)-9-benzyl-9-azabicyclo[3.3.1]nonan-3-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1C[C@H]2CCC[C@@H](C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C15H22N2.2ClH/c16-13-9-14-7-4-8-15(10-13)17(14)11-12-5-2-1-3-6-12;;/h1-3,5-6,13-15H,4,7-11,16H2;2*1H/t13?,14-,15+;; |
| InChIKey | QCOIRTCFGMEMDF-YCUJEXCHSA-N |
| XLogP | 3.37 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |