C14H19NO — CID 10751259
(1R,2R,5S)-8-benzyl-8-azabicyclo[3.2.1]octan-2-ol (PubChem CID 10751259) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (1R,2R,5S)-8-benzyl-8-azabicyclo[3.2.1]octan-2-ol.
| Compound Name | (1R,2R,5S)-8-benzyl-8-azabicyclo[3.2.1]octan-2-ol |
|---|---|
| PubChem CID | 10751259 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (1R,2R,5S)-8-benzyl-8-azabicyclo[3.2.1]octan-2-ol |
| SMILES | O[C@@H]1CC[C@@H]2CC[C@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C14H19NO/c16-14-9-7-12-6-8-13(14)15(12)10-11-4-2-1-3-5-11/h1-5,12-14,16H,6-10H2/t12-,13+,14+/m0/s1 |
| InChIKey | FHKHUCUXDIOPGQ-BFHYXJOUSA-N |
| XLogP | 2.17 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |