C15H20N2 — CID 124677901
(1R,3S,6R,8S)-2-benzyl-2,7-diazatricyclo[4.4.0.03,8]decane (PubChem CID 124677901) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (1R,3S,6R,8S)-2-benzyl-2,7-diazatricyclo[4.4.0.03,8]decane.
| Compound Name | (1R,3S,6R,8S)-2-benzyl-2,7-diazatricyclo[4.4.0.03,8]decane |
|---|---|
| PubChem CID | 124677901 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (1R,3S,6R,8S)-2-benzyl-2,7-diazatricyclo[4.4.0.03,8]decane |
| SMILES | c1ccc(CN2[C@@H]3CC[C@@H]4N[C@@H]3CC[C@@H]42)cc1 |
| InChI | InChI=1S/C15H20N2/c1-2-4-11(5-3-1)10-17-14-8-6-12-15(17)9-7-13(14)16-12/h1-5,12-16H,6-10H2/t12-,13+,14+,15- |
| InChIKey | HEZWRUYVMHWPAQ-PYHGIMPFSA-N |
| XLogP | 2.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |