C12H16N2 — CID 98061344
(1S,5S)-3-benzyl-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 98061344) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (1S,5S)-3-benzyl-3,6-diazabicyclo[3.1.1]heptane.
| Compound Name | (1S,5S)-3-benzyl-3,6-diazabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 98061344 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (1S,5S)-3-benzyl-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | c1ccc(CN2C[C@@H]3C[C@@H](C2)N3)cc1 |
| InChI | InChI=1S/C12H16N2/c1-2-4-10(5-3-1)7-14-8-11-6-12(9-14)13-11/h1-5,11-13H,6-9H2/t11-,12-/m0/s1 |
| InChIKey | HSMOPMLUYDDHIO-RYUDHWBXSA-N |
| XLogP | 1.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |