C13H19NO4 — CID 10824756
(3S,4R,5R,6S)-1-benzylazepane-3,4,5,6-tetrol (PubChem CID 10824756) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is (3S,4R,5R,6S)-1-benzylazepane-3,4,5,6-tetrol.
| Compound Name | (3S,4R,5R,6S)-1-benzylazepane-3,4,5,6-tetrol |
|---|---|
| PubChem CID | 10824756 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (3S,4R,5R,6S)-1-benzylazepane-3,4,5,6-tetrol |
| SMILES | O[C@H]1[C@H](O)[C@@H](O)CN(Cc2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C13H19NO4/c15-10-7-14(6-9-4-2-1-3-5-9)8-11(16)13(18)12(10)17/h1-5,10-13,15-18H,6-8H2/t10-,11-,12+,13+/m0/s1 |
| InChIKey | BNKDZUBTWKOJBR-WUHRBBMRSA-N |
| XLogP | -1.05 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |