C18H21NO3 — CID 22127210
1-benzyl-4-(4-hydroxyphenyl)piperidine-3,5-diol (PubChem CID 22127210) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-benzyl-4-(4-hydroxyphenyl)piperidine-3,5-diol.
| Compound Name | 1-benzyl-4-(4-hydroxyphenyl)piperidine-3,5-diol |
|---|---|
| PubChem CID | 22127210 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-benzyl-4-(4-hydroxyphenyl)piperidine-3,5-diol |
| SMILES | Oc1ccc(C2C(O)CN(Cc3ccccc3)CC2O)cc1 |
| InChI | InChI=1S/C18H21NO3/c20-15-8-6-14(7-9-15)18-16(21)11-19(12-17(18)22)10-13-4-2-1-3-5-13/h1-9,16-18,20-22H,10-12H2 |
| InChIKey | VRDCYBFNTBGXTL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |