C39H39NO3 — CID 67496163
(3S,4S,5S)-1-benzyl-4-(4-methoxyphenyl)-5-(trityloxymethyl)piperidin-3-ol (PubChem CID 67496163) has the molecular formula C39H39NO3 and a molecular weight of 569.75 g/mol. Its IUPAC name is (3S,4S,5S)-1-benzyl-4-(4-methoxyphenyl)-5-(trityloxymethyl)piperidin-3-ol.
| Compound Name | (3S,4S,5S)-1-benzyl-4-(4-methoxyphenyl)-5-(trityloxymethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 67496163 |
| Molecular Formula | C39H39NO3 |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | (3S,4S,5S)-1-benzyl-4-(4-methoxyphenyl)-5-(trityloxymethyl)piperidin-3-ol |
| SMILES | COc1ccc([C@@H]2[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)CN(Cc3ccccc3)C[C@H]2O)cc1 |
| InChI | InChI=1S/C39H39NO3/c1-42-36-24-22-31(23-25-36)38-32(27-40(28-37(38)41)26-30-14-6-2-7-15-30)29-43-39(33-16-8-3-9-17-33,34-18-10-4-11-19-34)35-20-12-5-13-21-35/h2-25,32,37-38,41H,26-29H2,1H3/t32-,37+,38+/m0/s1 |
| InChIKey | KJYNKGDPPQZHPR-WXUYMIOXSA-N |
| XLogP | 7.28 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|