C40H39NO5 — CID 140545546
benzyl (3R,4R,5S)-3-hydroxy-4-(4-methoxyphenyl)-2-methyl-5-trityloxypiperidine-1-carboxylate (PubChem CID 140545546) has the molecular formula C40H39NO5 and a molecular weight of 613.75 g/mol. Its IUPAC name is benzyl (3R,4R,5S)-3-hydroxy-4-(4-methoxyphenyl)-2-methyl-5-trityloxypiperidine-1-carboxylate.
| Compound Name | benzyl (3R,4R,5S)-3-hydroxy-4-(4-methoxyphenyl)-2-methyl-5-trityloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 140545546 |
| Molecular Formula | C40H39NO5 |
| Molecular Weight | 613.75 g/mol |
| Exact Mass | 613.28 |
| IUPAC Name | benzyl (3R,4R,5S)-3-hydroxy-4-(4-methoxyphenyl)-2-methyl-5-trityloxypiperidine-1-carboxylate |
| SMILES | COc1ccc([C@H]2[C@H](OC(c3ccccc3)(c3ccccc3)c3ccccc3)CN(C(=O)OCc3ccccc3)C(C)[C@@H]2O)cc1 |
| InChI | InChI=1S/C40H39NO5/c1-29-38(42)37(31-23-25-35(44-2)26-24-31)36(27-41(29)39(43)45-28-30-15-7-3-8-16-30)46-40(32-17-9-4-10-18-32,33-19-11-5-12-20-33)34-21-13-6-14-22-34/h3-26,29,36-38,42H,27-28H2,1-2H3/t29?,36-,37+,38+/m1/s1 |
| InChIKey | GMHFVUWYXGTIOE-PYQFHEKUSA-N |
| XLogP | 7.56 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.75 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|