C43H47NO3 — CID 139787605
1-benzyl-2-tert-butyl-4-(4-methoxyphenyl)-5-(trityloxymethyl)piperidin-3-ol (PubChem CID 139787605) has the molecular formula C43H47NO3 and a molecular weight of 625.85 g/mol. Its IUPAC name is 1-benzyl-2-tert-butyl-4-(4-methoxyphenyl)-5-(trityloxymethyl)piperidin-3-ol.
| Compound Name | 1-benzyl-2-tert-butyl-4-(4-methoxyphenyl)-5-(trityloxymethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 139787605 |
| Molecular Formula | C43H47NO3 |
| Molecular Weight | 625.85 g/mol |
| Exact Mass | 625.36 |
| IUPAC Name | 1-benzyl-2-tert-butyl-4-(4-methoxyphenyl)-5-(trityloxymethyl)piperidin-3-ol |
| SMILES | COc1ccc(C2C(COC(c3ccccc3)(c3ccccc3)c3ccccc3)CN(Cc3ccccc3)C(C(C)(C)C)C2O)cc1 |
| InChI | InChI=1S/C43H47NO3/c1-42(2,3)41-40(45)39(33-25-27-38(46-4)28-26-33)34(30-44(41)29-32-17-9-5-10-18-32)31-47-43(35-19-11-6-12-20-35,36-21-13-7-14-22-36)37-23-15-8-16-24-37/h5-28,34,39-41,45H,29-31H2,1-4H3 |
| InChIKey | XJAQALXQDGYUCC-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.85 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|