C26H29NO3 — CID 71457986
(2R,5S)-2-benzhydryl-5-[(4-methoxyphenyl)methylamino]oxan-4-ol (PubChem CID 71457986) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is (2R,5S)-2-benzhydryl-5-[(4-methoxyphenyl)methylamino]oxan-4-ol.
| Compound Name | (2R,5S)-2-benzhydryl-5-[(4-methoxyphenyl)methylamino]oxan-4-ol |
|---|---|
| PubChem CID | 71457986 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (2R,5S)-2-benzhydryl-5-[(4-methoxyphenyl)methylamino]oxan-4-ol |
| SMILES | COc1ccc(CN[C@H]2CO[C@@H](C(c3ccccc3)c3ccccc3)CC2O)cc1 |
| InChI | InChI=1S/C26H29NO3/c1-29-22-14-12-19(13-15-22)17-27-23-18-30-25(16-24(23)28)26(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-15,23-28H,16-18H2,1H3/t23-,24?,25+/m0/s1 |
| InChIKey | KRIXHIHYAWAVJT-QNRWSGHRSA-N |
| XLogP | 4.14 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |