C28H32N2O5 — CID 71457997
(3R,6R)-6-benzhydryl-N-[(4-methoxyphenyl)methyl]piperidin-3-amine;oxalic acid (PubChem CID 71457997) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is (3R,6R)-6-benzhydryl-N-[(4-methoxyphenyl)methyl]piperidin-3-amine;oxalic acid.
| Compound Name | (3R,6R)-6-benzhydryl-N-[(4-methoxyphenyl)methyl]piperidin-3-amine;oxalic acid |
|---|---|
| PubChem CID | 71457997 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (3R,6R)-6-benzhydryl-N-[(4-methoxyphenyl)methyl]piperidin-3-amine;oxalic acid |
| SMILES | COc1ccc(CN[C@@H]2CC[C@H](C(c3ccccc3)c3ccccc3)NC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H30N2O.C2H2O4/c1-29-24-15-12-20(13-16-24)18-27-23-14-17-25(28-19-23)26(21-8-4-2-5-9-21)22-10-6-3-7-11-22;3-1(4)2(5)6/h2-13,15-16,23,25-28H,14,17-19H2,1H3;(H,3,4)(H,5,6)/t23-,25-;/m1./s1 |
| InChIKey | DAGLLGNBEUPRHQ-ZHEQYFEDSA-N |
| XLogP | 3.89 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|